What is the condensed formula of 3 Methylheptane?

What is the condensed formula of 3 Methylheptane?

3-Methylheptane is a branched alkane isomeric to octane. Its structural formula is CH3CH2CH(CH3)CH2CH2CH2CH3. It has one stereocenter. Its refractive index is 1.398 (20 °C, D).

What is the condensed structural formula of benzene?

C6H6
The chemical formula of benzene is C6H6, so it consists of six carbon atoms and six hydrogen atoms. Benzene is an aromatic hydrocarbon, which is a chemical compound consisting of carbon and hydrogen atoms with alternating double bonds forming a ring.

What is the structure of 3 Methylheptane?

C8H18
3-Methylheptane/Formula

What is a condensed structural formula give an example?

In other words, we write it down in simply one line listing the atoms in the order which they occupy in the molecule. For instance, the condensed structural formula of methane is CH4 and propanol is CH3 (CH2)2OH. …

What is the condensed structural formula of octene?

1-Octene

PubChem CID 8125
Chemical Safety Laboratory Chemical Safety Summary (LCSS) Datasheet
Molecular Formula C8H16 or CH3(CH2)5CH=CH2
Synonyms 1-OCTENE Oct-1-ene 111-66-0 Caprylene n-1-Octene More…
Molecular Weight 112.21

What is the structural formula of cyclohexane?

C6H12
Cyclohexane/Formula
Cyclohexane has the chemical formula of C6H12. It forms a ring, so there are no CH3 ends, instead each carbon is attached to a CH2. The simplest way to draw cyclohexane is simply draw a hexagon.

What is the IUPAC formula for 3-octene?

3-Octene 1 Formula: C 8 H 16 2 Molecular weight: 112.2126 3 IUPAC Standard InChI: InChI=1S/C8H16/c1-3-5-7-8-6-4-2/h5,7H,3-4,6,8H2,1-2H3 Copy Sheet of paper on top of another sheet 4 IUPAC Standard InChIKey: YCTDZYMMFQCTEO-UHFFFAOYSA-N Copy Sheet of paper on top of another sheet 5 CAS Registry Number: 592-98-3

What is benzaldehyde made of?

Benzaldehyde is an arenecarbaldehyde that consists of benzene bearing a single formyl substituent; the simplest aromatic aldehyde and parent of the class of benzaldehydes.

What is the flash point of benzaldehyde?

Benzaldehyde, purum, >=98.0% (GC) Benzaldehyde appears as a clear colorless to yellow liquid with a bitter almond odor. Flash point near 145°F. More denser than water and insoluble in water. Hence sinks in water. Vapors are heavier than air. The primary hazard is to the environment.